Bromocresol purple
From Wikipedia, the free encyclopedia
| Bromocresol purple | |
|---|---|
 |
|
| IUPAC name | 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)- bis(2-bromo-6-methylphenol) |
| Other names | 5',5''-Dibromo-o-cresolsulfonephthalein |
| Identifiers | |
| CAS number | [115-40-2] |
| PubChem | |
| SMILES | Cc1cc(cc(Br)c1O)C3(OS(=O)(=O)c2ccccc23)c4cc(C)c(O)c(Br)c4 |
| Properties | |
| Molecular formula | C21H16Br2O5S |
| Molar mass | 540.223 |
| Appearance | Purple powder |
| Melting point |
241 - 242 °C (decomposition) |
| Solubility in water | < 0.1 % |
| Hazards | |
| NFPA 704 |
 0
1
0
|
| R-phrases | R36/37/38 |
| S-phrases | S26, S36 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Bromocresol Purple (BCP),or 5',5"-dibromo-o-cresolsulfophthalein, is a pH indicator with the chemical formula C21H16Br2O5S. The primary use of Bromocresol Purple is as a pH indicator; the most common solution is 0.04% aqueous.
Bromocresol Purple is also used in medical laboratories to measure albumin.
| Bromocresol Purple (pH indicator) | ||
| below pH 5.2 | above pH 6.8 | |
| 5.2 | ↔ | 6.8 |
[edit] References
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
| International Chemical Identifier | |
|---|---|
| InChI= | 1/C21H17BrO5S/c1-12-9-14(7-8-18(12)23)21(15-10-13(2)20(24)17(22)11-15)16-5-3-4-6-19(16)28(25,26)27-21/h3-11,23-24H,1-2H3 |
| InChIKey= | |
| CASRN= | |
| PIN= | |
