Bisamine
From Wikipedia, the free encyclopedia
| Bisamine | |
|---|---|
 |
|
| IUPAC name | 4-[(4-Amino-3-chlorophenyl)methyl]-2-chloroaniline |
| Other names | •4,4'-Methylene-bis(2-chloroaniline) •Cyanaset •Quodorole •Dacpm •Curalin M •Diamet Kh •Millionate M •Bis amine •MOCA •Bisamine S |
| Identifiers | |
| CAS number | [101-14-4] |
| PubChem | |
| SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)N)Cl)Cl)N |
| Properties | |
| Molecular formula | C13H12Cl2N2 |
| Molar mass | 267.15 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Bisamine, or 4,4’-methylene-bis(2-chloroaniline), is a substance used in polyurethane production.[1]
It is a toxin to the human body and is metabolized by the enzyme CYP2A6.
[edit] References
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
