Biebrich scarlet
From Wikipedia, the free encyclopedia
| Biebrich scarlet | |
|---|---|
 |
|
| IUPAC name | 2-[(2Z)-2-(2-oxonaphthalen-1-ylidene)hydrazinyl]-5-(4-sulfophenyl)diazenyl-benzenesulfonic acid |
| Other names | Croceine scarlet |
| Identifiers | |
| CAS number | [4196-99-0] |
| PubChem | |
| MeSH | |
| SMILES | C1=CC=C2C(=C1)C=CC(=O)C2=NNC3=C(C=C(C=C3)N=NC4=CC=C(C=C4)S(=O)(=O)O)S(=O)(=O)O |
| Properties | |
| Molecular formula | C22H16N4O7S2 |
| Molar mass | 512.517 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Biebrich scarlet (C.I. 26905) is a molecule used in Lillie's trichrome.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
