Avobenzone (data page)
From Wikipedia, the free encyclopedia
| The complete data for Avobenzone | ||||||||||||||||
| General information Chemical formula: C20H22O3
Molar mass: 310.387 [1] g·mol-1 Systematic name: 1-(4-methoxyphenyl)-3-(4-tert-butylphenyl)propane-1,3-dione [1] Synonyms: 1-(4-(1,1-dimethylethyl)phenyl)-3-(4-methoxyphenyl)-1,3-propanedione 1-(4-(1,1-dimethylethyl)phenyl)-3-(4-methoxyphenyl)propane-1,3-dione 4-tert-butyl-4'-methoxydibenzoylmethane Butyl methoxydibenzoylmethane Parsol 1789 Photoplex |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CC(C)(C)C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=C(C=C2)OC [1] InChI=1/C20H22O3/c1-20(2,3)16-9-5-14(6-10-16)18(21)13-19(22)15-7-11-17(23-4)12-8-15/h5-12H,13H2,1-4H3 [1]
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||

