Argininosuccinic acid
From Wikipedia, the free encyclopedia
| Argininosuccinic acid | |
|---|---|
 |
|
| IUPAC name | (2S)-2-[ [Amino-[(4S)-4-amino-5-hydroxy-5-oxopentyl]iminomethyl]amino]butanedioic acid |
| Identifiers | |
| CAS number | [2387-71-5] |
| PubChem | |
| SMILES | C(CC(C(=O)O)N)CN=C(N)NC(CC(=O)O)C(=O)O |
| Properties | |
| Molecular formula | C10H18N4O6 |
| Molar mass | 290.27312 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Argininosuccinic acid is a chemical compound which is a basic amino acid.
[edit] Reactions
Some cells synthesize argininosuccinic acid from citrulline and aspartic acid and use it as a precursor for arginine in the urea cycle or citrulline-NO cycle. The enzyme that catalyzes the reaction is argininosuccinate synthetase.
Argininosuccinic acid is a precursor to fumarate in the citric acid cycle via argininosuccinate lyase.
[edit] See also
|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
