Apocarotenal
From Wikipedia, the free encyclopedia
| Apocarotenal | |
|---|---|
 |
|
| IUPAC name | (2E,4E,6E,8E,10E,12E,14E,16E)-2,6,11,15-tetramethyl-17-(2,6,6-trimethyl-1-cyclohexenyl)heptadeca-2,4,6,8,10,12,14,16-octaenal |
| Other names | trans-beta-apo-8'-carotenal C.I. Food Orange 6 E number 160E |
| Identifiers | |
| CAS number | [1107-26-2] |
| PubChem | |
| SMILES | CC=1CCCC(C)(C)C=1/C=CC(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)C=O |
| Properties | |
| Molecular formula | C30H40O |
| Molar mass | 416.638 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Apocarotenal, or trans-beta-apo-8'-carotenal, is a carotenoid found in spinach and citrus fruits. Like other carotenoids, apocarotenal plays a role as a precursor of vitamin A, even though it has 50% less pro-vitamin A activity than beta-carotene. The empirical chemical formula for apocarotenal is C30H40O.
Apocarotenal has an orange to orange-red colour and is used in foods, pharmaceuticals and cosmetic products. Depending on the product forms, apocarotenal is used in fat based food (margarine, sauces, salad dressing), beverages, dairy products and sweets. Its E number is 160E.
