Anthrapurpurin
From Wikipedia, the free encyclopedia
| Anthrapurpurin | |
|---|---|
 |
|
| IUPAC name | 1,2,7-Trihydroxyanthracene-9,10-dione |
| Other names | 1,2,7-Trihydroxyanthraquinone |
| Identifiers | |
| CAS number | [602-65-3] |
| PubChem | |
| SMILES | C1=CC2=C(C=C1O)C(=O)C3=C(C2=O)C=CC(=C3O)O |
| Properties | |
| Molecular formula | C14H8O5 |
| Molar mass | 256.21032 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Anthrapurpurin, or 1,2,7-trihdroxyanthraquinone, is a purple dye used in histology for the detection of calcium.[1]
[edit] See also
[edit] References
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
