alpha-Furil
From Wikipedia, the free encyclopedia
| α-Furil | |
|---|---|
 |
|
| IUPAC name | 1,2-di(furan-2-yl)ethane-1,2-dione |
| Other names | Bipyromucyl; Di-2-furanylethanedione; Di-2-furylglyoxal; di-2-furanyl-; 2,2'-Furil |
| Identifiers | |
| CAS number | [492-94-4] |
| SMILES | C1=COC(=C1)C(=O)C(=O)C2=CC=CO2 |
| Properties | |
| Molecular formula | C10H6O4 |
| Molar mass | 190.15 g/mol |
| Appearance | yellow-brown powder |
| Melting point |
163-165° C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
α-Furil, also commonly known as 2,2'-furil, is a furan compound.
[edit] References
 |
This article about a heterocyclic compound is a stub. You can help Wikipedia by expanding it. |
