Adrenosterone
From Wikipedia, the free encyclopedia
| Adrenosterone | |
|---|---|
 |
|
| IUPAC name | (8S,9S,10R,13S,14S)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16- decahydrocyclopenta[a]phenanthrene-3,11,17-trione |
| Other names | Reichstein's substance G |
| Identifiers | |
| CAS number | [382-45-6] |
| PubChem | |
| MeSH | |
| SMILES | CC12CCC(=O)C=C1CCC3C2C(=O)CC4(C3CCC4=O)C |
| Properties | |
| Molecular formula | C19H24O3 |
| Molar mass | 300.392 g/mol |
| Melting point |
222°C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Adrenosterone is a steroid hormone with weak androgenic effect. It was first isolated in 1936 from the adrenal cortex by Tadeus Reichstein at the Pharmaceutical Institute in the University of Basel. Originally, adrenosterone was called Reichstein's substance G.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
