Acibenzolar-S-methyl
From Wikipedia, the free encyclopedia
| Acibenzolar-S-methyl[1] | |
|---|---|
 |
|
| IUPAC name | S-Methyl 1,2,3-benzothiadiazole-7-carbothioate |
| Identifiers | |
| CAS number | [135158-54-2] |
| PubChem | |
| SMILES | CSC(=O)C1=C2C(=CC=C1)N=NS2 |
| Properties | |
| Molecular formula | C8H6N2OS2 |
| Molar mass | 210.28 g/mol |
| Appearance | Beige fine powder |
| Melting point |
132.9 °C |
| Solubility in water | 7.7 mg/L |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Acibenzolar-S-methyl is a fungicide that works by activating a plant's own defense system by increasing the transcription of W-box controlled genes such as CAD1, NPR1 and PR2. It is a methyl derivative of acibenzolar.
[edit] References
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
