8-Hydroxyguanosine
From Wikipedia, the free encyclopedia
| 8-Hydroxyguanosine | |
|---|---|
 |
|
| IUPAC name | 2-Amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-tetrahydrofuranyl]-3,7-dihydropurine-6,8-dione |
| Other names | 8-Oxoguanosine |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C(C1C(C(C(O1)N2C3=C(C(=O)N=C(N3)N)NC2=O)O)O)O |
| Properties | |
| Molecular formula | C10H13N5O6 |
| Molar mass | 299.24 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
8-Hydroxyguanosine is a nucleoside which is an oxidative derivative of guanosine. Measurement of the levels of 8-hydroxyguanosine is used as a biomarker of oxidative stress.[1]
[edit] References
- ^ Cattley RC, Glover SE (1993). "Elevated 8-hydroxydeoxyguanosine in hepatic DNA of rats following exposure to peroxisome proliferators: relationship to carcinogenesis and nuclear localization". Carcinogenesis 14 (12): 2495–9. PMID 8269617.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
