8-Chlorotheophylline
From Wikipedia, the free encyclopedia
| 8-Chlorotheophylline | |
|---|---|
| IUPAC name | 8-chloro-1,3-dimethyl-7H-purine-2,6-dione |
| Other names | 1,3-Dimethyl-8-chloroxanthine |
| Identifiers | |
| CAS number | [85-18-7] |
| PubChem | |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)Cl |
| Properties | |
| Molecular formula | C7H7ClN4O2 |
| Molar mass | 214.609 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
8-Chlorotheophylline is a xanthine derivative. It is combined with pharmaceutical drugs to form stable salts, such as dimenhydrinate.

