7-Hydroxyamoxapine
From Wikipedia, the free encyclopedia
| 7-Hydroxyamoxapine | |
|---|---|
 |
|
| IUPAC name | 2-chloro-11-(piperazin-1-yl)dibenzo [b,f][1,4]oxazepin-7-ol |
| Identifiers | |
| CAS number | [37081-76-8] |
| PubChem | |
| SMILES | C1CN(CCN1)C2=NC3=C(C=C(C=C3)O)OC4=C2C=C(C=C4)Cl |
| Properties | |
| Molecular formula | C17H16ClN3O2 |
| Molar mass | 329.781 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
7-Hydroxyamoxapine is a metabolite of amoxapine.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
