7-Dehydrositosterol
From Wikipedia, the free encyclopedia
| 7-Dehydrositosterol | |
|---|---|
| IUPAC name | (3β)-Stigmasta-5,7-dien-3-ol |
| Identifiers | |
| CAS number | [521-04-0] |
| PubChem | |
| SMILES | C[C@H](CC[C@@H](CC)C(C)C)[C@@]4([H])CC[C@@]3([H])C2=CC=C1C[C@@H](O)CC[C@@](C)1[C@]([H])2CC[C@@]34C |
| Properties | |
| Molecular formula | C29H48O |
| Molar mass | 412.691 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
7-Dehydrositosterol is a sterol which serves as a precursor for sitocalciferol (vitamin D5).

