5-Hydroxyisourate
From Wikipedia, the free encyclopedia
| 5-Hydroxyisourate | |
|---|---|
 |
|
| IUPAC name | 5-hydroxy-3,7-dihydropurine-2,6,8-trione |
| Identifiers | |
| CAS number | [6960-30-1] |
| PubChem | |
| MeSH | |
| SMILES | C12=NC(=O)NC1(C(=O)NC(=O)N2)O |
| Properties | |
| Molecular formula | C5H4N4O4 |
| Molar mass | 184.11 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
5-Hydroxyisourate is a molecule with a formula of C5H4N4O4 and molecular weight of 184.110 g/mol. It is the product of the oxidation of uric acid by urate oxidase.
[edit] See also
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
