4-Phenyl-4-(1-piperidinyl)cyclohexanol
From Wikipedia, the free encyclopedia
| 4-Phenyl-4-(1-piperidinyl)cyclohexanol | |
|---|---|
cyclohexanol-Line-Structure.png/200px-4-phenyl-4-(1-piperidinyl)cyclohexanol-Line-Structure.png) |
|
cyclohexanol-Space-filling.png/200px-4-phenyl-4-(1-piperidinyl)cyclohexanol-Space-filling.png) |
|
| IUPAC name | 4-Phenyl-4-(1-piperidinyl)cyclohexanol |
| Identifiers | |
| CAS number | [60756-83-4] |
| PubChem | |
| SMILES | OC1CCC(N2CCCCC2)(C3=CC=CC=C3)CC1 |
| Properties | |
| Molecular formula | C17H25NO |
| Molar mass | 259.391 g/mol |
| Boiling point |
161.0 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
4-Phenyl-4-(1-piperidinyl)-cyclohexanol, also known as PPC, is an organic chemical which is often found as a metabolite of phencyclidine (PCP).
 |
This article about an amine is a stub. You can help Wikipedia by expanding it. |
