3-Methylheptane
From Wikipedia, the free encyclopedia
| 3-Methylheptane | |
|---|---|
| IUPAC name | 3-Methylheptane |
| Other names | 2-Ethylhexane |
| Identifiers | |
| CAS number | [589-81-1] |
| PubChem | |
| EINECS number | |
| SMILES | CCCCC(C)CC |
| InChI | 1/C8H18/c1-4-6-7-8(3)5-2/h8H,4-7H2,1-3H3 |
| Properties | |
| Molecular formula | C8H18 |
| Molar mass | 114.23 g.mol-1 |
| Appearance | Clear liquid |
| Density | 0.705 g.cm-3 |
| Melting point |
-121 °C, 152 K, -186 °F |
| Boiling point |
+119 °C, 392 K, 246 °F |
| Hazards | |
| Main hazards | Harmful (Xn), Highly flammable (F+), Dangerous for the environment (N) |
| R-phrases | R11, R38, R50/53, R65, R67 |
| S-phrases | S9, S16, S29, S33, S60, S61, S62 |
| Flash point | 7.2 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
Its refractive index is 1.398 (20 °C, D).
[edit] External links
- Non-stereospecific oxidation of DL-3-methylheptane by aPseudomonas
- Physical and chemical properties table
|
||||||||

