24-Ethyl coprostanol
From Wikipedia, the free encyclopedia
| 24-Ethyl coprostanol | |
|---|---|
 |
|
| Other names | (3β,5β)-Stigmastan-3-ol, 5β-Stigmastan-3b-ol, (24R)-Ethylcoprostanol, 24a-Ethylcoprostanol, Copro-β-sitostanol, Coprostigmastanol |
| Identifiers | |
| CAS number | [4736-91-8] |
| SMILES | O[C@H]1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@@]([H])2CC[C@@]4(C)[C@]([H])3CC[C@@]([H])4[C@@H](CCC(CC)C(C)C)C)([H])C1 |
| Properties | |
| Molecular formula | C29H52O |
| Molar mass | 416.72 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
24-Ethyl coprostanol (24-ethyl 5β-cholestan-3β-ol) is a 29 carbon stanol formed from the biohydrogenation of β-sitosterol (24-ethyl cholest-5en-3β-ol, 24-ethyl cholesterol) in the gastrointestinal tract of most higher animals, especially herbivores. This compound has been used as a biomarker for the presence of agricultural (non-human) faecal matter in the environment.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
