1-Naphthaleneacetamide
From Wikipedia, the free encyclopedia
| 1-Naphthaleneacetamide | |
|---|---|
| IUPAC name | 2-Naphthalen-1-ylacetamide |
| Other names | 1-Naphthylacetamide |
| Identifiers | |
| CAS number | [86-86-2] |
| PubChem | |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)N |
| Properties | |
| Molecular formula | C12H11NO |
| Molar mass | 185.222 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1-Naphthaleneacetamide is a synthetic auxin that acts as a rooting hormone. It can be found in commercial products such as Rootone.

