1-methylnaphthalene
From Wikipedia, the free encyclopedia
| 1-methylnaphthalene[1] | |
|---|---|
 |
|
 |
|
| IUPAC name | 1-Methylnaphthalene |
| Other names | α-methylnaphthalene |
| Identifiers | |
| CAS number | [90-12-0] |
| PubChem | |
| EINECS number | |
| SMILES | CC1=CC=CC2=CC=CC=C12 |
| InChI | InChI=1/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
| Properties | |
| Molecular formula | C11H10 |
| Molar mass | 142.1971 |
| Appearance | Liquid |
| Density | 1.001 g/mL |
| Melting point |
−22°C |
| Boiling point |
240-243 °C, 270 K, -165 °F |
| Vapor pressure | 4.91 |
| Hazards | |
| R-phrases | R22 R42 R43 |
| S-phrases | S7 S36 S37 S39 |
| Flash point | 82°C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1-Methylnaphthalene is an aromatic hydrocarbon. It has a cetane number of zero, and was previously used as the lower reference for cetane number. However, due to the expense and handling difficulty of 1-Methylnaphthalene, it was replaced in this capacity by isocetane, with a CN of 15[2].
[edit] References
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
