1-Deoxy-D-xylulose 5-phosphate
From Wikipedia, the free encyclopedia
| 1-Deoxy-D-xylulose 5-phosphate | |
|---|---|
| IUPAC name | (2,3-dihydroxy-4-oxopentyl) dihydrogen phosphate |
| Other names | DOXP |
| Identifiers | |
| CAS number | [190079-18-6] |
| PubChem | |
| MeSH | |
| SMILES | CC(=O)[C@H]([C@@H](COP(=O)(O)O)O)O |
| Properties | |
| Molecular formula | C5H11O7P |
| Molar mass | 214.11 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1-Deoxy-D-xylulose 5-phosphate is an intermediate in the non-mevalonate pathway.

