1-(2-Nitrophenoxy)octane
From Wikipedia, the free encyclopedia
| 1-(2-Nitrophenoxy)octane | |
|---|---|
 |
|
| IUPAC name | 1-(2-nitrophenoxy)octane |
| Other names | 2-Nitrophenyl octyl ether, 1-nitro-2-octoxy-benzene, 2-(Octyloxy)nitrobenzene, Octyl o-nitrophenyl ether, 1-Nitro-2-(octyloxy)benzene |
| Abbreviations | NPOE |
| Identifiers | |
| CAS number | [37682-29-4] |
| PubChem | |
| SMILES | CCCCCCCCOC1=CC=CC=C1[N+](=O)[O-] |
| Properties | |
| Molecular formula | C14H21NO3 |
| Molar mass | 251.321 |
| Density | 1.04 g/mL |
| Boiling point |
197-198 °C 11 mm Hg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1-(2-Nitrophenoxy)octane, also known as nitrophenyl octyl ether and abbreviated NPOE, is a chemical compound that is used as a matrix in fast atom bombardment mass spectrometry and liquid secondary ion mass spectrometry.
