1,8-Diazafluoren-9-one
From Wikipedia, the free encyclopedia
| 1,8-Diazafluoren-9-one | |
|---|---|
| IUPAC name | 1,8-Diazafluoren-9-one |
| Other names | DFO 9H-1,8-Diazafluoren-9-one 9H-Cyclopenta[1,2-b:4,3-b']dipyridin-9-one |
| Identifiers | |
| CAS number | [54078-29-4] |
| SMILES | O=C1C3=C(C=CC=N3)C2=C1N=CC=C2 |
| Properties | |
| Molecular formula | C11H6N2O |
| Molar mass | 182.18 g/mol |
| Melting point |
229-233 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1,8-Diazafluoren-9-one, also known as DFO, is a chemical that is used to find fingerprints on porous surfaces. It makes fingerprints glow when they are lit by blue-green light.
DFO reacts with amino acids present in the fingerprint to form highly fluorescent derivatives. Excitation with light at ~470 nm results in emission at ~570 nm.[1]
[edit] References
- ^ C.A. Pounds et al. J. Forensic Sci. 35, 169, (1990)

