1,2,3,4-Tetraphenylnaphthalene
From Wikipedia, the free encyclopedia
| 1,2,3,4-Tetraphenylnaphthalene[1] | |
|---|---|
 |
|
| IUPAC name | 1,2,3,4-Tetra(phenyl)naphthalene |
| Identifiers | |
| CAS number | [751-38-2] |
| PubChem | |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C3=CC=CC=C32)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
| Properties | |
| Molecular formula | C34H24 |
| Molar mass | 432.55 g/mol |
| Melting point |
199-201 °C |
| Hazards | |
| R-phrases | R36/37/38 |
| S-phrases | S26 S36 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
1,2,3,4-Tetraphenylnaphthalene is a polycyclic aromatic hydrocarbon commonly prepared in the undergraduate teaching laboratory as an introduction to the Diels-Alder reaction, in this case between benzyne (generated in situ) and tetraphenylcyclopentadienone.
[edit] References
 |
This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |
